About methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate
methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate (PubChem CID 13398396) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate |
| PubChem CID | 13398396 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c3ccccc3n(C)c2[nH]1 |
| InChI | InChI=1S/C13H12N2O2/c1-15-11-6-4-3-5-8(11)9-7-10(13(16)17-2)14-12(9)15/h3-7,14H,1-2H3 |
| InChIKey | KXNVLGAKOXQCEV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate?
The IUPAC name of methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate (CID 13398396) is methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate.
What is the SMILES notation for methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate?
The canonical SMILES for methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate is COC(=O)c1cc2c3ccccc3n(C)c2[nH]1.
What is the InChIKey of methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate?
The InChIKey is KXNVLGAKOXQCEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c1-15-11-6-4-3-5-8(11)9-7-10(13(16)17-2)14-12(9)15/h3-7,14H,1-2H3.
What are the key properties of methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate?
methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate has a molecular weight of 228.25 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylate is sourced from PubChem (CID 13398396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).