C12H10N2O3 — CID 115007774
7-hydroxy-4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylic acid (PubChem CID 115007774) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 7-hydroxy-4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylic acid.
| Compound Name | 7-hydroxy-4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 115007774 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 7-hydroxy-4-methyl-3H-pyrrolo[2,3-b]indole-2-carboxylic acid |
| SMILES | Cn1c2ccc(O)cc2c2cc(C(=O)O)[nH]c21 |
| InChI | InChI=1S/C12H10N2O3/c1-14-10-3-2-6(15)4-7(10)8-5-9(12(16)17)13-11(8)14/h2-5,13,15H,1H3,(H,16,17) |
| InChIKey | LPSPLXXRYJVSPC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |