About 6-hydroxy-1,2-dimethylquinolin-4-one
6-hydroxy-1,2-dimethylquinolin-4-one (PubChem CID 130032779) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 6-hydroxy-1,2-dimethylquinolin-4-one.
Molecular Properties
| Compound Name | 6-hydroxy-1,2-dimethylquinolin-4-one |
| PubChem CID | 130032779 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 6-hydroxy-1,2-dimethylquinolin-4-one |
| SMILES | Cc1cc(=O)c2cc(O)ccc2n1C |
| InChI | InChI=1S/C11H11NO2/c1-7-5-11(14)9-6-8(13)3-4-10(9)12(7)2/h3-6,13H,1-2H3 |
| InChIKey | FRTDLYRJQWVUNQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-hydroxy-1,2-dimethylquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1,2-dimethylquinolin-4-one?
The IUPAC name of 6-hydroxy-1,2-dimethylquinolin-4-one (CID 130032779) is 6-hydroxy-1,2-dimethylquinolin-4-one.
What is the SMILES notation for 6-hydroxy-1,2-dimethylquinolin-4-one?
The canonical SMILES for 6-hydroxy-1,2-dimethylquinolin-4-one is Cc1cc(=O)c2cc(O)ccc2n1C.
What is the InChIKey of 6-hydroxy-1,2-dimethylquinolin-4-one?
The InChIKey is FRTDLYRJQWVUNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-7-5-11(14)9-6-8(13)3-4-10(9)12(7)2/h3-6,13H,1-2H3.
What are the key properties of 6-hydroxy-1,2-dimethylquinolin-4-one?
6-hydroxy-1,2-dimethylquinolin-4-one has a molecular weight of 189.21 g/mol, XLogP of 1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1,2-dimethylquinolin-4-one is sourced from PubChem (CID 130032779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).