C11H11NO2 — CID 130032779
6-hydroxy-1,2-dimethylquinolin-4-one (PubChem CID 130032779) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 6-hydroxy-1,2-dimethylquinolin-4-one.
| Compound Name | 6-hydroxy-1,2-dimethylquinolin-4-one |
|---|---|
| PubChem CID | 130032779 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 6-hydroxy-1,2-dimethylquinolin-4-one |
| SMILES | Cc1cc(=O)c2cc(O)ccc2n1C |
| InChI | InChI=1S/C11H11NO2/c1-7-5-11(14)9-6-8(13)3-4-10(9)12(7)2/h3-6,13H,1-2H3 |
| InChIKey | FRTDLYRJQWVUNQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |