C12H10N2O2 — CID 115028655
6-hydroxy-9-methyl-2H-pyrido[3,4-b]indol-3-one (PubChem CID 115028655) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 6-hydroxy-9-methyl-2H-pyrido[3,4-b]indol-3-one.
| Compound Name | 6-hydroxy-9-methyl-2H-pyrido[3,4-b]indol-3-one |
|---|---|
| PubChem CID | 115028655 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 6-hydroxy-9-methyl-2H-pyrido[3,4-b]indol-3-one |
| SMILES | Cn1c2ccc(O)cc2c2cc(=O)[nH]cc21 |
| InChI | InChI=1S/C12H10N2O2/c1-14-10-3-2-7(15)4-8(10)9-5-12(16)13-6-11(9)14/h2-6,15H,1H3,(H,13,16) |
| InChIKey | LXHFMDWFUASHMB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |