C12H16FNO — CID 145147289
ethane;3-fluoro-1,2-dimethylindol-5-ol (PubChem CID 145147289) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is ethane;3-fluoro-1,2-dimethylindol-5-ol.
| Compound Name | ethane;3-fluoro-1,2-dimethylindol-5-ol |
|---|---|
| PubChem CID | 145147289 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | ethane;3-fluoro-1,2-dimethylindol-5-ol |
| SMILES | CC.Cc1c(F)c2cc(O)ccc2n1C |
| InChI | InChI=1S/C10H10FNO.C2H6/c1-6-10(11)8-5-7(13)3-4-9(8)12(6)2;1-2/h3-5,13H,1-2H3;1-2H3 |
| InChIKey | XLGAJJOQVQWBPT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |