About ethane;3-fluoro-1,2-dimethylindol-5-ol
ethane;3-fluoro-1,2-dimethylindol-5-ol (PubChem CID 145147289) has the molecular formula C12H16FNO
and a molecular weight of 209.26 g/mol. Its IUPAC name is ethane;3-fluoro-1,2-dimethylindol-5-ol.
Molecular Properties
| Compound Name | ethane;3-fluoro-1,2-dimethylindol-5-ol |
| PubChem CID | 145147289 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | ethane;3-fluoro-1,2-dimethylindol-5-ol |
| SMILES | CC.Cc1c(F)c2cc(O)ccc2n1C |
| InChI | InChI=1S/C10H10FNO.C2H6/c1-6-10(11)8-5-7(13)3-4-9(8)12(6)2;1-2/h3-5,13H,1-2H3;1-2H3 |
| InChIKey | XLGAJJOQVQWBPT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-fluoro-1,2-dimethylindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-fluoro-1,2-dimethylindol-5-ol?
The IUPAC name of ethane;3-fluoro-1,2-dimethylindol-5-ol (CID 145147289) is ethane;3-fluoro-1,2-dimethylindol-5-ol.
What is the SMILES notation for ethane;3-fluoro-1,2-dimethylindol-5-ol?
The canonical SMILES for ethane;3-fluoro-1,2-dimethylindol-5-ol is CC.Cc1c(F)c2cc(O)ccc2n1C.
What is the InChIKey of ethane;3-fluoro-1,2-dimethylindol-5-ol?
The InChIKey is XLGAJJOQVQWBPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO.C2H6/c1-6-10(11)8-5-7(13)3-4-9(8)12(6)2;1-2/h3-5,13H,1-2H3;1-2H3.
What are the key properties of ethane;3-fluoro-1,2-dimethylindol-5-ol?
ethane;3-fluoro-1,2-dimethylindol-5-ol has a molecular weight of 209.26 g/mol, XLogP of 3.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-fluoro-1,2-dimethylindol-5-ol is sourced from PubChem (CID 145147289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).