C11H10BrNO3 — CID 13400039
3-(bromomethyl)-4-(2-oxoazetidin-1-yl)benzoic acid (PubChem CID 13400039) has the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. Its IUPAC name is 3-(bromomethyl)-4-(2-oxoazetidin-1-yl)benzoic acid.
| Compound Name | 3-(bromomethyl)-4-(2-oxoazetidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 13400039 |
| Molecular Formula | C11H10BrNO3 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 3-(bromomethyl)-4-(2-oxoazetidin-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCC2=O)c(CBr)c1 |
| InChI | InChI=1S/C11H10BrNO3/c12-6-8-5-7(11(15)16)1-2-9(8)13-4-3-10(13)14/h1-2,5H,3-4,6H2,(H,15,16) |
| InChIKey | MLTLOTBNHJDHIO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|