C18H26N6O3 — CID 134005143
(5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone (PubChem CID 134005143) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is (5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 134005143 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1NNC2CCC([N+](=O)[O-])CC21)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C18H26N6O3/c25-18(17-15-11-14(24(26)27)1-2-16(15)20-21-17)23-9-7-22(8-10-23)12-13-3-5-19-6-4-13/h3-6,14-17,20-21H,1-2,7-12H2 |
| InChIKey | QXXMJDIVBVTACJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 103.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|