C20H28ClN5O4 — CID 134028034
N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 134028034) has the molecular formula C20H28ClN5O4 and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 134028034 |
| Molecular Formula | C20H28ClN5O4 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(NCC(c1ccc(Cl)cc1)N1CCOCC1)C1NNC2CCC([N+](=O)[O-])CC21 |
| InChI | InChI=1S/C20H28ClN5O4/c21-14-3-1-13(2-4-14)18(25-7-9-30-10-8-25)12-22-20(27)19-16-11-15(26(28)29)5-6-17(16)23-24-19/h1-4,15-19,23-24H,5-12H2,(H,22,27) |
| InChIKey | CDISDFQDLLBBFN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|