C9H12N2O — CID 13400653
N-methyl-2-(5-methyl-2-pyridinyl)acetamide (PubChem CID 13400653) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is N-methyl-2-(5-methyl-2-pyridinyl)acetamide.
| Compound Name | N-methyl-2-(5-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 13400653 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N-methyl-2-(5-methyl-2-pyridinyl)acetamide |
| SMILES | CNC(=O)Cc1ccc(C)cn1 |
| InChI | InChI=1S/C9H12N2O/c1-7-3-4-8(11-6-7)5-9(12)10-2/h3-4,6H,5H2,1-2H3,(H,10,12) |
| InChIKey | WJVFEROMBKWWFJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |