C14H11Cl2NO — CID 66448114
1-(3,5-dichlorophenyl)-2-(5-methyl-2-pyridinyl)ethanone (PubChem CID 66448114) has the molecular formula C14H11Cl2NO and a molecular weight of 280.15 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-2-(5-methyl-2-pyridinyl)ethanone.
| Compound Name | 1-(3,5-dichlorophenyl)-2-(5-methyl-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 66448114 |
| Molecular Formula | C14H11Cl2NO |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-2-(5-methyl-2-pyridinyl)ethanone |
| SMILES | Cc1ccc(CC(=O)c2cc(Cl)cc(Cl)c2)nc1 |
| InChI | InChI=1S/C14H11Cl2NO/c1-9-2-3-13(17-8-9)7-14(18)10-4-11(15)6-12(16)5-10/h2-6,8H,7H2,1H3 |
| InChIKey | IDCGHZIACVDDHQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |