C15H24N4O3S — CID 134006724
[4-(4-ethylpiperazin-1-yl)sulfonyl-1H-pyrrol-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 134006724) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is [4-(4-ethylpiperazin-1-yl)sulfonyl-1H-pyrrol-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-(4-ethylpiperazin-1-yl)sulfonyl-1H-pyrrol-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 134006724 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [4-(4-ethylpiperazin-1-yl)sulfonyl-1H-pyrrol-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CCN1CCN(S(=O)(=O)c2c[nH]c(C(=O)N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C15H24N4O3S/c1-2-17-7-9-19(10-8-17)23(21,22)13-11-14(16-12-13)15(20)18-5-3-4-6-18/h11-12,16H,2-10H2,1H3 |
| InChIKey | FRIHDKATYLMKDG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |