C13H21N3O4S — CID 115869488
N-(1-hydroxypropan-2-yl)-N-methyl-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 115869488) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-N-methyl-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-N-methyl-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115869488 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-N-methyl-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | CC(CO)N(C)C(=O)c1cc(S(=O)(=O)N2CCCC2)c[nH]1 |
| InChI | InChI=1S/C13H21N3O4S/c1-10(9-17)15(2)13(18)12-7-11(8-14-12)21(19,20)16-5-3-4-6-16/h7-8,10,14,17H,3-6,9H2,1-2H3 |
| InChIKey | MZDMYCXTLSRWSL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |