C19H25N3O4S — CID 18119321
N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 18119321) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18119321 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | Cc1ccc(OCCN(C)C(=O)c2cc(S(=O)(=O)N3CCCC3)c[nH]2)cc1 |
| InChI | InChI=1S/C19H25N3O4S/c1-15-5-7-16(8-6-15)26-12-11-21(2)19(23)18-13-17(14-20-18)27(24,25)22-9-3-4-10-22/h5-8,13-14,20H,3-4,9-12H2,1-2H3 |
| InChIKey | RWFYRDVJCDNUPH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |