C18H19F2NOS — CID 134008249
2-(3,4-difluorophenyl)sulfanyl-N-(2-phenylbutyl)acetamide (PubChem CID 134008249) has the molecular formula C18H19F2NOS and a molecular weight of 335.42 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-N-(2-phenylbutyl)acetamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-N-(2-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 134008249 |
| Molecular Formula | C18H19F2NOS |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-N-(2-phenylbutyl)acetamide |
| SMILES | CCC(CNC(=O)CSc1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H19F2NOS/c1-2-13(14-6-4-3-5-7-14)11-21-18(22)12-23-15-8-9-16(19)17(20)10-15/h3-10,13H,2,11-12H2,1H3,(H,21,22) |
| InChIKey | MIEDSYMOFPECNF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |