C17H17F2NO — CID 26687345
2,5-difluoro-N-[(2R)-2-phenylbutyl]benzamide (PubChem CID 26687345) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is 2,5-difluoro-N-[(2R)-2-phenylbutyl]benzamide.
| Compound Name | 2,5-difluoro-N-[(2R)-2-phenylbutyl]benzamide |
|---|---|
| PubChem CID | 26687345 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2,5-difluoro-N-[(2R)-2-phenylbutyl]benzamide |
| SMILES | CC[C@@H](CNC(=O)c1cc(F)ccc1F)c1ccccc1 |
| InChI | InChI=1S/C17H17F2NO/c1-2-12(13-6-4-3-5-7-13)11-20-17(21)15-10-14(18)8-9-16(15)19/h3-10,12H,2,11H2,1H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | STUZDXACGAZRLW-LBPRGKRZSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |