C27H28N4O3 — CID 134009668
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]benzamide (PubChem CID 134009668) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]benzamide.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 134009668 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]benzamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)c1cccc(OCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C27H28N4O3/c1-29(18-21-8-10-24(11-9-21)30-13-15-33-16-14-30)27(32)22-5-4-6-25(17-22)34-20-23-19-31-12-3-2-7-26(31)28-23/h2-12,17,19H,13-16,18,20H2,1H3 |
| InChIKey | QNGKYDYGFROHDC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|