About adamantane-1-carbonyl fluoride
adamantane-1-carbonyl fluoride (PubChem CID 13401042) has the molecular formula C11H15FO
and a molecular weight of 182.24 g/mol. Its IUPAC name is adamantane-1-carbonyl fluoride.
Molecular Properties
| Compound Name | adamantane-1-carbonyl fluoride |
| PubChem CID | 13401042 |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | adamantane-1-carbonyl fluoride |
| SMILES | O=C(F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H15FO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2 |
| InChIKey | RGDWWJZTKRRCIM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze adamantane-1-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-1-carbonyl fluoride?
The IUPAC name of adamantane-1-carbonyl fluoride (CID 13401042) is adamantane-1-carbonyl fluoride.
What is the SMILES notation for adamantane-1-carbonyl fluoride?
The canonical SMILES for adamantane-1-carbonyl fluoride is O=C(F)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of adamantane-1-carbonyl fluoride?
The InChIKey is RGDWWJZTKRRCIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2.
What are the key properties of adamantane-1-carbonyl fluoride?
adamantane-1-carbonyl fluoride has a molecular weight of 182.24 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-1-carbonyl fluoride is sourced from PubChem (CID 13401042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).