C25H25ClN2O3 — CID 134012020
3-acetamido-N-benzyl-3-(4-chlorophenyl)-N-(4-methoxyphenyl)propanamide (PubChem CID 134012020) has the molecular formula C25H25ClN2O3 and a molecular weight of 436.94 g/mol. Its IUPAC name is 3-acetamido-N-benzyl-3-(4-chlorophenyl)-N-(4-methoxyphenyl)propanamide.
| Compound Name | 3-acetamido-N-benzyl-3-(4-chlorophenyl)-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 134012020 |
| Molecular Formula | C25H25ClN2O3 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3-acetamido-N-benzyl-3-(4-chlorophenyl)-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(N(Cc2ccccc2)C(=O)CC(NC(C)=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H25ClN2O3/c1-18(29)27-24(20-8-10-21(26)11-9-20)16-25(30)28(17-19-6-4-3-5-7-19)22-12-14-23(31-2)15-13-22/h3-15,24H,16-17H2,1-2H3,(H,27,29) |
| InChIKey | DEGFWYYYSPXEKG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |