C23H23ClN2O3 — CID 55495044
3-acetamido-3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)propanamide (PubChem CID 55495044) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is 3-acetamido-3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)propanamide.
| Compound Name | 3-acetamido-3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 55495044 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-acetamido-3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-N-(4-methylphenyl)propanamide |
| SMILES | CC(=O)NC(CC(=O)N(Cc1ccco1)c1ccc(C)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN2O3/c1-16-5-11-20(12-6-16)26(15-21-4-3-13-29-21)23(28)14-22(25-17(2)27)18-7-9-19(24)10-8-18/h3-13,22H,14-15H2,1-2H3,(H,25,27) |
| InChIKey | JENFBXWNWZBPTC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |