C18H14Cl2N2O2 — CID 3721578
3-(3-chlorophenyl)-1-(4-chlorophenyl)-1-(furan-2-ylmethyl)urea (PubChem CID 3721578) has the molecular formula C18H14Cl2N2O2 and a molecular weight of 361.23 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(4-chlorophenyl)-1-(furan-2-ylmethyl)urea.
| Compound Name | 3-(3-chlorophenyl)-1-(4-chlorophenyl)-1-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 3721578 |
| Molecular Formula | C18H14Cl2N2O2 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(4-chlorophenyl)-1-(furan-2-ylmethyl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)N(Cc1ccco1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O2/c19-13-6-8-16(9-7-13)22(12-17-5-2-10-24-17)18(23)21-15-4-1-3-14(20)11-15/h1-11H,12H2,(H,21,23) |
| InChIKey | NANUERGXVGRSDA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |