C20H18ClNO2 — CID 35345535
4-chloro-N-(3,4-dimethylphenyl)-N-(furan-2-ylmethyl)benzamide (PubChem CID 35345535) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is 4-chloro-N-(3,4-dimethylphenyl)-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-chloro-N-(3,4-dimethylphenyl)-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 35345535 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 4-chloro-N-(3,4-dimethylphenyl)-N-(furan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(N(Cc2ccco2)C(=O)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C20H18ClNO2/c1-14-5-10-18(12-15(14)2)22(13-19-4-3-11-24-19)20(23)16-6-8-17(21)9-7-16/h3-12H,13H2,1-2H3 |
| InChIKey | MPJUPFVBUJBBAO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |