C21H19F2NO4 — CID 18267461
4-(difluoromethoxy)-N-(furan-2-ylmethyl)-3-methoxy-N-(4-methylphenyl)benzamide (PubChem CID 18267461) has the molecular formula C21H19F2NO4 and a molecular weight of 387.38 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(furan-2-ylmethyl)-3-methoxy-N-(4-methylphenyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-N-(furan-2-ylmethyl)-3-methoxy-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 18267461 |
| Molecular Formula | C21H19F2NO4 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-(difluoromethoxy)-N-(furan-2-ylmethyl)-3-methoxy-N-(4-methylphenyl)benzamide |
| SMILES | COc1cc(C(=O)N(Cc2ccco2)c2ccc(C)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C21H19F2NO4/c1-14-5-8-16(9-6-14)24(13-17-4-3-11-27-17)20(25)15-7-10-18(28-21(22)23)19(12-15)26-2/h3-12,21H,13H2,1-2H3 |
| InChIKey | DYFCTTNSEHKWBT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |