C20H19NO4 — CID 18100555
N-(furan-2-ylmethyl)-3,5-dimethoxy-N-phenylbenzamide (PubChem CID 18100555) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3,5-dimethoxy-N-phenylbenzamide.
| Compound Name | N-(furan-2-ylmethyl)-3,5-dimethoxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 18100555 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-3,5-dimethoxy-N-phenylbenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(Cc2ccco2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H19NO4/c1-23-18-11-15(12-19(13-18)24-2)20(22)21(14-17-9-6-10-25-17)16-7-4-3-5-8-16/h3-13H,14H2,1-2H3 |
| InChIKey | ZRTCHVLISWIWNU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |