C17H17F2N3O3S — CID 22305987
1-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]-1-(4-methylphenyl)thiourea (PubChem CID 22305987) has the molecular formula C17H17F2N3O3S and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]-1-(4-methylphenyl)thiourea.
| Compound Name | 1-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]-1-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 22305987 |
| Molecular Formula | C17H17F2N3O3S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-methoxybenzoyl]amino]-1-(4-methylphenyl)thiourea |
| SMILES | COc1cc(C(=O)NN(C(N)=S)c2ccc(C)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C17H17F2N3O3S/c1-10-3-6-12(7-4-10)22(17(20)26)21-15(23)11-5-8-13(25-16(18)19)14(9-11)24-2/h3-9,16H,1-2H3,(H2,20,26)(H,21,23) |
| InChIKey | NWZUOBYGFKPYOA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|