C16H15Cl2N5O2 — CID 134015284
3,6-dichloro-N'-(5-phenylpyrazolidine-3-carbonyl)pyridine-2-carbohydrazide (PubChem CID 134015284) has the molecular formula C16H15Cl2N5O2 and a molecular weight of 380.24 g/mol. Its IUPAC name is 3,6-dichloro-N'-(5-phenylpyrazolidine-3-carbonyl)pyridine-2-carbohydrazide.
| Compound Name | 3,6-dichloro-N'-(5-phenylpyrazolidine-3-carbonyl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 134015284 |
| Molecular Formula | C16H15Cl2N5O2 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 3,6-dichloro-N'-(5-phenylpyrazolidine-3-carbonyl)pyridine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC(c2ccccc2)NN1)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H15Cl2N5O2/c17-10-6-7-13(18)19-14(10)16(25)23-22-15(24)12-8-11(20-21-12)9-4-2-1-3-5-9/h1-7,11-12,20-21H,8H2,(H,22,24)(H,23,25) |
| InChIKey | YZVKIIPTOWHTQP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|