C20H24N4O3 — CID 84865575
N'-[2-(2,6-dimethylphenoxy)acetyl]-5-phenylpyrazolidine-3-carbohydrazide (PubChem CID 84865575) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is N'-[2-(2,6-dimethylphenoxy)acetyl]-5-phenylpyrazolidine-3-carbohydrazide.
| Compound Name | N'-[2-(2,6-dimethylphenoxy)acetyl]-5-phenylpyrazolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 84865575 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N'-[2-(2,6-dimethylphenoxy)acetyl]-5-phenylpyrazolidine-3-carbohydrazide |
| SMILES | Cc1cccc(C)c1OCC(=O)NNC(=O)C1CC(c2ccccc2)NN1 |
| InChI | InChI=1S/C20H24N4O3/c1-13-7-6-8-14(2)19(13)27-12-18(25)23-24-20(26)17-11-16(21-22-17)15-9-4-3-5-10-15/h3-10,16-17,21-22H,11-12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | OTIQYTFYOJHBDZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|