About N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide
N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 134015302) has the molecular formula C16H20N2OS2
and a molecular weight of 320.48 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| PubChem CID | 134015302 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCCN(CC1CC1)C(=O)Cc1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C16H20N2OS2/c1-2-7-18(10-12-5-6-12)15(19)9-13-11-21-16(17-13)14-4-3-8-20-14/h3-4,8,11-12H,2,5-7,9-10H2,1H3 |
| InChIKey | OPOYDYVWWFEJHF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide?
The IUPAC name of N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (CID 134015302) is N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide?
The canonical SMILES for N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide is CCCN(CC1CC1)C(=O)Cc1csc(-c2cccs2)n1.
What is the InChIKey of N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide?
The InChIKey is OPOYDYVWWFEJHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2OS2/c1-2-7-18(10-12-5-6-12)15(19)9-13-11-21-16(17-13)14-4-3-8-20-14/h3-4,8,11-12H,2,5-7,9-10H2,1H3.
What are the key properties of N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide?
N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide has a molecular weight of 320.48 g/mol, XLogP of 4.06, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-N-propyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 134015302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).