C24H28N4OS2 — CID 134016385
N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide (PubChem CID 134016385) has the molecular formula C24H28N4OS2 and a molecular weight of 452.65 g/mol. Its IUPAC name is N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide.
| Compound Name | N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 134016385 |
| Molecular Formula | C24H28N4OS2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide |
| SMILES | Cc1csc(SCc2ccc(C(=O)Nc3ccc(N4CCN(C)CC4)c(C)c3)cc2)n1 |
| InChI | InChI=1S/C24H28N4OS2/c1-17-14-21(8-9-22(17)28-12-10-27(3)11-13-28)26-23(29)20-6-4-19(5-7-20)16-31-24-25-18(2)15-30-24/h4-9,14-15H,10-13,16H2,1-3H3,(H,26,29) |
| InChIKey | XPVZKFKJVFAFAK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|