C17H20ClN3O3S — CID 134018887
N-[1-(2-chlorophenyl)ethyl]-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide (PubChem CID 134018887) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)ethyl]-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-[1-(2-chlorophenyl)ethyl]-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 134018887 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[1-(2-chlorophenyl)ethyl]-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1c[nH]c(C(=O)N2CCCC2)c1)c1ccccc1Cl |
| InChI | InChI=1S/C17H20ClN3O3S/c1-12(14-6-2-3-7-15(14)18)20-25(23,24)13-10-16(19-11-13)17(22)21-8-4-5-9-21/h2-3,6-7,10-12,19-20H,4-5,8-9H2,1H3 |
| InChIKey | SEYQTZDLHSBUPY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |