C15H27ClN4O3S — CID 119993343
N-(1-aminohexan-2-yl)-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide;hydrochloride (PubChem CID 119993343) has the molecular formula C15H27ClN4O3S and a molecular weight of 378.93 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119993343 |
| Molecular Formula | C15H27ClN4O3S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-(1-aminohexan-2-yl)-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-sulfonamide;hydrochloride |
| SMILES | CCCCC(CN)NS(=O)(=O)c1c[nH]c(C(=O)N2CCCC2)c1.Cl |
| InChI | InChI=1S/C15H26N4O3S.ClH/c1-2-3-6-12(10-16)18-23(21,22)13-9-14(17-11-13)15(20)19-7-4-5-8-19;/h9,11-12,17-18H,2-8,10,16H2,1H3;1H |
| InChIKey | UEMNFAJKKKHVCX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |