C11H11F6NO — CID 13401927
2-[4-(dimethylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 13401927) has the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-(dimethylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 13401927 |
| Molecular Formula | C11H11F6NO |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CN(C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F6NO/c1-18(2)8-5-3-7(4-6-8)9(19,10(12,13)14)11(15,16)17/h3-6,19H,1-2H3 |
| InChIKey | KLFJZPAKMSBSIM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|