C19H24N2O3S — CID 134021901
[4-(4-ethyl-5-propylthiophene-2-carbonyl)piperazin-1-yl]-(furan-3-yl)methanone (PubChem CID 134021901) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is [4-(4-ethyl-5-propylthiophene-2-carbonyl)piperazin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-(4-ethyl-5-propylthiophene-2-carbonyl)piperazin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 134021901 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [4-(4-ethyl-5-propylthiophene-2-carbonyl)piperazin-1-yl]-(furan-3-yl)methanone |
| SMILES | CCCc1sc(C(=O)N2CCN(C(=O)c3ccoc3)CC2)cc1CC |
| InChI | InChI=1S/C19H24N2O3S/c1-3-5-16-14(4-2)12-17(25-16)19(23)21-9-7-20(8-10-21)18(22)15-6-11-24-13-15/h6,11-13H,3-5,7-10H2,1-2H3 |
| InChIKey | NWBVTTYXKVVACZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |