C21H28N2O4S2 — CID 26260997
(4-ethyl-5-propylthiophen-2-yl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 26260997) has the molecular formula C21H28N2O4S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is (4-ethyl-5-propylthiophen-2-yl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (4-ethyl-5-propylthiophen-2-yl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26260997 |
| Molecular Formula | C21H28N2O4S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (4-ethyl-5-propylthiophen-2-yl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CCCc1sc(C(=O)N2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)cc1CC |
| InChI | InChI=1S/C21H28N2O4S2/c1-4-6-19-16(5-2)15-20(28-19)21(24)22-11-13-23(14-12-22)29(25,26)18-9-7-17(27-3)8-10-18/h7-10,15H,4-6,11-14H2,1-3H3 |
| InChIKey | HUOLDAPKYRRHLG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |