C18H30N2OS — CID 134022151
2-tert-butylsulfanyl-N-[[2-(diethylaminomethyl)phenyl]methyl]acetamide (PubChem CID 134022151) has the molecular formula C18H30N2OS and a molecular weight of 322.52 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-[[2-(diethylaminomethyl)phenyl]methyl]acetamide.
| Compound Name | 2-tert-butylsulfanyl-N-[[2-(diethylaminomethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 134022151 |
| Molecular Formula | C18H30N2OS |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-tert-butylsulfanyl-N-[[2-(diethylaminomethyl)phenyl]methyl]acetamide |
| SMILES | CCN(CC)Cc1ccccc1CNC(=O)CSC(C)(C)C |
| InChI | InChI=1S/C18H30N2OS/c1-6-20(7-2)13-16-11-9-8-10-15(16)12-19-17(21)14-22-18(3,4)5/h8-11H,6-7,12-14H2,1-5H3,(H,19,21) |
| InChIKey | NFUMNLDXSGTFJI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |