C22H30N2O — CID 134022161
N-[[2-(diethylaminomethyl)phenyl]methyl]-2-methyl-2-phenylpropanamide (PubChem CID 134022161) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[[2-(diethylaminomethyl)phenyl]methyl]-2-methyl-2-phenylpropanamide.
| Compound Name | N-[[2-(diethylaminomethyl)phenyl]methyl]-2-methyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 134022161 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-[[2-(diethylaminomethyl)phenyl]methyl]-2-methyl-2-phenylpropanamide |
| SMILES | CCN(CC)Cc1ccccc1CNC(=O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O/c1-5-24(6-2)17-19-13-11-10-12-18(19)16-23-21(25)22(3,4)20-14-8-7-9-15-20/h7-15H,5-6,16-17H2,1-4H3,(H,23,25) |
| InChIKey | VCGLKCQWNCVMTG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |