C22H26N2O4 — CID 134023136
1-(2-ethoxyphenyl)-N-[[2-(methoxymethyl)phenyl]methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 134023136) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-N-[[2-(methoxymethyl)phenyl]methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-ethoxyphenyl)-N-[[2-(methoxymethyl)phenyl]methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134023136 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-(2-ethoxyphenyl)-N-[[2-(methoxymethyl)phenyl]methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1ccccc1N1CC(C(=O)NCc2ccccc2COC)CC1=O |
| InChI | InChI=1S/C22H26N2O4/c1-3-28-20-11-7-6-10-19(20)24-14-18(12-21(24)25)22(26)23-13-16-8-4-5-9-17(16)15-27-2/h4-11,18H,3,12-15H2,1-2H3,(H,23,26) |
| InChIKey | XMRHLCUUCQRQGC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |