C24H29N3O5 — CID 134024016
[2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone (PubChem CID 134024016) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone.
| Compound Name | [2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 134024016 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone |
| SMILES | COc1ccc(C2CCCN2C(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)cc1OC |
| InChI | InChI=1S/C24H29N3O5/c1-31-22-10-9-18(16-23(22)32-2)19-8-5-13-26(19)24(28)17-11-14-25(15-12-17)20-6-3-4-7-21(20)27(29)30/h3-4,6-7,9-10,16-17,19H,5,8,11-15H2,1-2H3 |
| InChIKey | XFPWFCNOLGPJPO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|