C15H19N5O3 — CID 134024169
N'-[2-(3,5-dimethylphenoxy)acetyl]-3-(1,2,4-triazol-1-yl)propanehydrazide (PubChem CID 134024169) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylphenoxy)acetyl]-3-(1,2,4-triazol-1-yl)propanehydrazide.
| Compound Name | N'-[2-(3,5-dimethylphenoxy)acetyl]-3-(1,2,4-triazol-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 134024169 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N'-[2-(3,5-dimethylphenoxy)acetyl]-3-(1,2,4-triazol-1-yl)propanehydrazide |
| SMILES | Cc1cc(C)cc(OCC(=O)NNC(=O)CCn2cncn2)c1 |
| InChI | InChI=1S/C15H19N5O3/c1-11-5-12(2)7-13(6-11)23-8-15(22)19-18-14(21)3-4-20-10-16-9-17-20/h5-7,9-10H,3-4,8H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | HMPNNDDAALKHDZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|