C20H19FN2O3S — CID 134024628
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 134024628) has the molecular formula C20H19FN2O3S and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134024628 |
| Molecular Formula | C20H19FN2O3S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCCSCc1ccccc1F)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C20H19FN2O3S/c21-17-6-2-1-5-15(17)14-27-12-10-22-20(25)18-9-8-16(26-18)13-23-11-4-3-7-19(23)24/h1-9,11H,10,12-14H2,(H,22,25) |
| InChIKey | WPAHOXMZIHRSKZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|