C22H25ClN2O2 — CID 134028185
(E)-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-phenylbut-2-enamide (PubChem CID 134028185) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is (E)-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-phenylbut-2-enamide.
| Compound Name | (E)-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 134028185 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (E)-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-3-phenylbut-2-enamide |
| SMILES | C/C(=C\C(=O)NCC(c1ccccc1Cl)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C22H25ClN2O2/c1-17(18-7-3-2-4-8-18)15-22(26)24-16-21(25-11-13-27-14-12-25)19-9-5-6-10-20(19)23/h2-10,15,21H,11-14,16H2,1H3,(H,24,26)/b17-15+ |
| InChIKey | SKWQDESOQCPZDG-BMRADRMJSA-N |
| XLogP | 3.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|