C22H21NO3 — CID 134029408
(E)-3-(2-ethoxyphenyl)-N-[furan-2-yl(phenyl)methyl]prop-2-enamide (PubChem CID 134029408) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (E)-3-(2-ethoxyphenyl)-N-[furan-2-yl(phenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-ethoxyphenyl)-N-[furan-2-yl(phenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 134029408 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (E)-3-(2-ethoxyphenyl)-N-[furan-2-yl(phenyl)methyl]prop-2-enamide |
| SMILES | CCOc1ccccc1/C=C/C(=O)NC(c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C22H21NO3/c1-2-25-19-12-7-6-9-17(19)14-15-21(24)23-22(20-13-8-16-26-20)18-10-4-3-5-11-18/h3-16,22H,2H2,1H3,(H,23,24)/b15-14+ |
| InChIKey | WFOXXLLXWBMFJW-CCEZHUSRSA-N |
| XLogP | 4.60 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|