C23H21NO4 — CID 55759749
8-ethoxy-N-[furan-2-yl(phenyl)methyl]-2H-chromene-3-carboxamide (PubChem CID 55759749) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is 8-ethoxy-N-[furan-2-yl(phenyl)methyl]-2H-chromene-3-carboxamide.
| Compound Name | 8-ethoxy-N-[furan-2-yl(phenyl)methyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 55759749 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 8-ethoxy-N-[furan-2-yl(phenyl)methyl]-2H-chromene-3-carboxamide |
| SMILES | CCOc1cccc2c1OCC(C(=O)NC(c1ccccc1)c1ccco1)=C2 |
| InChI | InChI=1S/C23H21NO4/c1-2-26-20-11-6-10-17-14-18(15-28-22(17)20)23(25)24-21(19-12-7-13-27-19)16-8-4-3-5-9-16/h3-14,21H,2,15H2,1H3,(H,24,25) |
| InChIKey | OWXAHVZJICIREG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |