C23H22FN3O3 — CID 55759495
8-ethoxy-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2H-chromene-3-carboxamide (PubChem CID 55759495) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is 8-ethoxy-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2H-chromene-3-carboxamide.
| Compound Name | 8-ethoxy-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 55759495 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 8-ethoxy-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2H-chromene-3-carboxamide |
| SMILES | CCOc1cccc2c1OCC(C(=O)NC(c1cccc(F)c1)c1nccn1C)=C2 |
| InChI | InChI=1S/C23H22FN3O3/c1-3-29-19-9-5-7-16-12-17(14-30-21(16)19)23(28)26-20(22-25-10-11-27(22)2)15-6-4-8-18(24)13-15/h4-13,20H,3,14H2,1-2H3,(H,26,28) |
| InChIKey | JNPLYZMTCPCUHB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |