C23H28N2O5S — CID 55759184
8-ethoxy-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-2H-chromene-3-carboxamide (PubChem CID 55759184) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is 8-ethoxy-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-2H-chromene-3-carboxamide.
| Compound Name | 8-ethoxy-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 55759184 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 8-ethoxy-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-2H-chromene-3-carboxamide |
| SMILES | CCOc1cccc2c1OCC(C(=O)NCc1ccccc1CS(=O)(=O)NC(C)C)=C2 |
| InChI | InChI=1S/C23H28N2O5S/c1-4-29-21-11-7-10-17-12-20(14-30-22(17)21)23(26)24-13-18-8-5-6-9-19(18)15-31(27,28)25-16(2)3/h5-12,16,25H,4,13-15H2,1-3H3,(H,24,26) |
| InChIKey | OOPCUELCTYRHEL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |