C18H24FNO2 — CID 134030048
(E)-N-(3-cyclohexyloxypropyl)-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 134030048) has the molecular formula C18H24FNO2 and a molecular weight of 305.39 g/mol. Its IUPAC name is (E)-N-(3-cyclohexyloxypropyl)-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(3-cyclohexyloxypropyl)-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 134030048 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (E)-N-(3-cyclohexyloxypropyl)-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1F)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C18H24FNO2/c19-17-10-5-4-7-15(17)11-12-18(21)20-13-6-14-22-16-8-2-1-3-9-16/h4-5,7,10-12,16H,1-3,6,8-9,13-14H2,(H,20,21)/b12-11+ |
| InChIKey | ADAXDOFRTJFDDQ-VAWYXSNFSA-N |
| XLogP | 3.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|