C18H19NO4S — CID 134030266
(4-ethylphenyl) 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (PubChem CID 134030266) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is (4-ethylphenyl) 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.
| Compound Name | (4-ethylphenyl) 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
|---|---|
| PubChem CID | 134030266 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (4-ethylphenyl) 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
| SMILES | CCc1ccc(OC(=O)c2ccc(N3CCCS3(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-2-14-4-10-17(11-5-14)23-18(20)15-6-8-16(9-7-15)19-12-3-13-24(19,21)22/h4-11H,2-3,12-13H2,1H3 |
| InChIKey | YYWQJHNEJGRJCZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|