C18H25NO4S — CID 78818907
(2-ethylcyclohexyl) 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (PubChem CID 78818907) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is (2-ethylcyclohexyl) 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.
| Compound Name | (2-ethylcyclohexyl) 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
|---|---|
| PubChem CID | 78818907 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (2-ethylcyclohexyl) 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
| SMILES | CCC1CCCCC1OC(=O)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C18H25NO4S/c1-2-14-6-3-4-7-17(14)23-18(20)15-8-10-16(11-9-15)19-12-5-13-24(19,21)22/h8-11,14,17H,2-7,12-13H2,1H3 |
| InChIKey | CKKRPVLBMPYFND-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |