[(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate

C15H19NO4S — CID 60554605

IUPAC[(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate
SMILESCC/C=C/COC(=O)c1ccc(N2CCCS2(=O)=O)cc1
InChIInChI=1S/C15H19NO4S/c1-2-3-4-11-20-15(17)13-6-8-14(9-7-13)16-10-5-12-21(16,18)19/h3-4,6-9H,2,5,10-12H2,1H3/b4-3+
InChIKeyIUZULRMAIDSVSF-ONEGZZNKSA-N
MW309.39 g/mol
LogP2.35
Rot. Bonds5

About [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate

[(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (PubChem CID 60554605) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.

Molecular Properties

Compound Name[(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate
PubChem CID60554605
Molecular FormulaC15H19NO4S
Molecular Weight309.39 g/mol
Exact Mass309.10
IUPAC Name[(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate
SMILESCC/C=C/COC(=O)c1ccc(N2CCCS2(=O)=O)cc1
InChIInChI=1S/C15H19NO4S/c1-2-3-4-11-20-15(17)13-6-8-14(9-7-13)16-10-5-12-21(16,18)19/h3-4,6-9H,2,5,10-12H2,1H3/b4-3+
InChIKeyIUZULRMAIDSVSF-ONEGZZNKSA-N
XLogP2.35
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.39
LogP ≤ 52.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate?
The IUPAC name of [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (CID 60554605) is [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.
What is the SMILES notation for [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate?
The canonical SMILES for [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate is CC/C=C/COC(=O)c1ccc(N2CCCS2(=O)=O)cc1.
What is the InChIKey of [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate?
The InChIKey is IUZULRMAIDSVSF-ONEGZZNKSA-N. The full InChI is InChI=1S/C15H19NO4S/c1-2-3-4-11-20-15(17)13-6-8-14(9-7-13)16-10-5-12-21(16,18)19/h3-4,6-9H,2,5,10-12H2,1H3/b4-3+.
What are the key properties of [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate?
[(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate has a molecular weight of 309.39 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-pent-2-enyl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate is sourced from PubChem (CID 60554605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).