C19H23FN2O — CID 134030730
2-(3-ethylanilino)-N-[(3-fluorophenyl)methyl]-N-methylpropanamide (PubChem CID 134030730) has the molecular formula C19H23FN2O and a molecular weight of 314.40 g/mol. Its IUPAC name is 2-(3-ethylanilino)-N-[(3-fluorophenyl)methyl]-N-methylpropanamide.
| Compound Name | 2-(3-ethylanilino)-N-[(3-fluorophenyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 134030730 |
| Molecular Formula | C19H23FN2O |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-(3-ethylanilino)-N-[(3-fluorophenyl)methyl]-N-methylpropanamide |
| SMILES | CCc1cccc(NC(C)C(=O)N(C)Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H23FN2O/c1-4-15-7-6-10-18(12-15)21-14(2)19(23)22(3)13-16-8-5-9-17(20)11-16/h5-12,14,21H,4,13H2,1-3H3 |
| InChIKey | PLCYGONNQUMEIM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |