C20H25FN2O4 — CID 134031135
N-[(3-fluorophenyl)methyl]-N-methyl-2-(3,4,5-trimethoxyanilino)propanamide (PubChem CID 134031135) has the molecular formula C20H25FN2O4 and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-methyl-2-(3,4,5-trimethoxyanilino)propanamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-methyl-2-(3,4,5-trimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 134031135 |
| Molecular Formula | C20H25FN2O4 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-methyl-2-(3,4,5-trimethoxyanilino)propanamide |
| SMILES | COc1cc(NC(C)C(=O)N(C)Cc2cccc(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25FN2O4/c1-13(20(24)23(2)12-14-7-6-8-15(21)9-14)22-16-10-17(25-3)19(27-5)18(11-16)26-4/h6-11,13,22H,12H2,1-5H3 |
| InChIKey | OZBOXUOBIKFFHZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|